C15H16BrN3O3S — CID 119241465
2-[2-[[1-(3-bromophenyl)-5-methylpyrazole-4-carbonyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241465) has the molecular formula C15H16BrN3O3S and a molecular weight of 398.28 g/mol. Its IUPAC name is 2-[2-[[1-(3-bromophenyl)-5-methylpyrazole-4-carbonyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[1-(3-bromophenyl)-5-methylpyrazole-4-carbonyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241465 |
| Molecular Formula | C15H16BrN3O3S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 2-[2-[[1-(3-bromophenyl)-5-methylpyrazole-4-carbonyl]amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1c(C(=O)NCCSCC(=O)O)cnn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C15H16BrN3O3S/c1-10-13(15(22)17-5-6-23-9-14(20)21)8-18-19(10)12-4-2-3-11(16)7-12/h2-4,7-8H,5-6,9H2,1H3,(H,17,22)(H,20,21) |
| InChIKey | RRBSWMQDGXQKBC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|