C19H21N3O4S — CID 119245364
2-[[[2-oxo-1-(4-propan-2-ylphenyl)pyrrolidine-3-carbonyl]amino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 119245364) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[[[2-oxo-1-(4-propan-2-ylphenyl)pyrrolidine-3-carbonyl]amino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[[2-oxo-1-(4-propan-2-ylphenyl)pyrrolidine-3-carbonyl]amino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 119245364 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[[[2-oxo-1-(4-propan-2-ylphenyl)pyrrolidine-3-carbonyl]amino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)c1ccc(N2CCC(C(=O)NCc3nc(C(=O)O)cs3)C2=O)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-11(2)12-3-5-13(6-4-12)22-8-7-14(18(22)24)17(23)20-9-16-21-15(10-27-16)19(25)26/h3-6,10-11,14H,7-9H2,1-2H3,(H,20,23)(H,25,26) |
| InChIKey | HZSBXKYNGCGBRT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|