C17H19NO4S — CID 119246078
5-[[(1-thiophen-2-ylcyclohexanecarbonyl)amino]methyl]furan-2-carboxylic acid (PubChem CID 119246078) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 5-[[(1-thiophen-2-ylcyclohexanecarbonyl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(1-thiophen-2-ylcyclohexanecarbonyl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 119246078 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 5-[[(1-thiophen-2-ylcyclohexanecarbonyl)amino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)C2(c3cccs3)CCCCC2)o1 |
| InChI | InChI=1S/C17H19NO4S/c19-15(20)13-7-6-12(22-13)11-18-16(21)17(8-2-1-3-9-17)14-5-4-10-23-14/h4-7,10H,1-3,8-9,11H2,(H,18,21)(H,19,20) |
| InChIKey | CPAIDFCXAJAKRA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |