C17H25NO2S — CID 111471238
N-[(2-hydroxycyclopentyl)methyl]-1-thiophen-2-ylcyclohexane-1-carboxamide (PubChem CID 111471238) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[(2-hydroxycyclopentyl)methyl]-1-thiophen-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-[(2-hydroxycyclopentyl)methyl]-1-thiophen-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 111471238 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[(2-hydroxycyclopentyl)methyl]-1-thiophen-2-ylcyclohexane-1-carboxamide |
| SMILES | O=C(NCC1CCCC1O)C1(c2cccs2)CCCCC1 |
| InChI | InChI=1S/C17H25NO2S/c19-14-7-4-6-13(14)12-18-16(20)17(9-2-1-3-10-17)15-8-5-11-21-15/h5,8,11,13-14,19H,1-4,6-7,9-10,12H2,(H,18,20) |
| InChIKey | CQYQFDJCUYAPEB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |