C20H30N2OS2 — CID 91813106
N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 91813106) has the molecular formula C20H30N2OS2 and a molecular weight of 378.61 g/mol. Its IUPAC name is N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 91813106 |
| Molecular Formula | C20H30N2OS2 |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[[1-(thiolan-3-yl)piperidin-4-yl]methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | O=C(NCC1CCN(C2CCSC2)CC1)C1(c2cccs2)CCCC1 |
| InChI | InChI=1S/C20H30N2OS2/c23-19(20(8-1-2-9-20)18-4-3-12-25-18)21-14-16-5-10-22(11-6-16)17-7-13-24-15-17/h3-4,12,16-17H,1-2,5-11,13-15H2,(H,21,23) |
| InChIKey | VSOKYTCHLQFFOW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |