C20H26N4OS — CID 71786595
N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 71786595) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 71786595 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | O=C(NCC1CCN(c2cnccn2)CC1)C1(c2cccs2)CCCC1 |
| InChI | InChI=1S/C20H26N4OS/c25-19(20(7-1-2-8-20)17-4-3-13-26-17)23-14-16-5-11-24(12-6-16)18-15-21-9-10-22-18/h3-4,9-10,13,15-16H,1-2,5-8,11-12,14H2,(H,23,25) |
| InChIKey | IIGZNLHTSOBSOK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |