C21H26N4O2 — CID 121109138
1-(2-methoxyphenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 121109138) has the molecular formula C21H26N4O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(2-methoxyphenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 121109138 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-(2-methoxyphenyl)-N-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccccc1C1(C(=O)NCC2CCN(c3cnccn3)CC2)CC1 |
| InChI | InChI=1S/C21H26N4O2/c1-27-18-5-3-2-4-17(18)21(8-9-21)20(26)24-14-16-6-12-25(13-7-16)19-15-22-10-11-23-19/h2-5,10-11,15-16H,6-9,12-14H2,1H3,(H,24,26) |
| InChIKey | ZYRQKRVKBBCJIS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |