C16H23N3O3 — CID 11924611
N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(3-nitroanilino)acetamide (PubChem CID 11924611) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(3-nitroanilino)acetamide.
| Compound Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(3-nitroanilino)acetamide |
|---|---|
| PubChem CID | 11924611 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(3-nitroanilino)acetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CNc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H23N3O3/c1-11-5-3-8-15(12(11)2)18-16(20)10-17-13-6-4-7-14(9-13)19(21)22/h4,6-7,9,11-12,15,17H,3,5,8,10H2,1-2H3,(H,18,20)/t11-,12-,15+/m1/s1 |
| InChIKey | NGTNILFNVVMJGX-JMSVASOKSA-N |
| XLogP | 2.95 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|