C22H27NO5 — CID 119246396
2-[3-[[2-(5-methyl-2-propan-2-ylphenoxy)propanoylamino]methyl]phenoxy]acetic acid (PubChem CID 119246396) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[3-[[2-(5-methyl-2-propan-2-ylphenoxy)propanoylamino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[2-(5-methyl-2-propan-2-ylphenoxy)propanoylamino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119246396 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-[3-[[2-(5-methyl-2-propan-2-ylphenoxy)propanoylamino]methyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(C(C)C)c(OC(C)C(=O)NCc2cccc(OCC(=O)O)c2)c1 |
| InChI | InChI=1S/C22H27NO5/c1-14(2)19-9-8-15(3)10-20(19)28-16(4)22(26)23-12-17-6-5-7-18(11-17)27-13-21(24)25/h5-11,14,16H,12-13H2,1-4H3,(H,23,26)(H,24,25) |
| InChIKey | SBANELULVSMBOB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |