C14H18N2O5 — CID 119246914
2-[3-[(2-acetamidopropanoylamino)methyl]phenoxy]acetic acid (PubChem CID 119246914) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[3-[(2-acetamidopropanoylamino)methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(2-acetamidopropanoylamino)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119246914 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[3-[(2-acetamidopropanoylamino)methyl]phenoxy]acetic acid |
| SMILES | CC(=O)NC(C)C(=O)NCc1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C14H18N2O5/c1-9(16-10(2)17)14(20)15-7-11-4-3-5-12(6-11)21-8-13(18)19/h3-6,9H,7-8H2,1-2H3,(H,15,20)(H,16,17)(H,18,19) |
| InChIKey | JBMNMFNTRTXDNA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |