C20H28N2O5 — CID 119246413
2-[3-[[2-[(2-cyclohexylacetyl)amino]propanoylamino]methyl]phenoxy]acetic acid (PubChem CID 119246413) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-[3-[[2-[(2-cyclohexylacetyl)amino]propanoylamino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[2-[(2-cyclohexylacetyl)amino]propanoylamino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119246413 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-[3-[[2-[(2-cyclohexylacetyl)amino]propanoylamino]methyl]phenoxy]acetic acid |
| SMILES | CC(NC(=O)CC1CCCCC1)C(=O)NCc1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C20H28N2O5/c1-14(22-18(23)11-15-6-3-2-4-7-15)20(26)21-12-16-8-5-9-17(10-16)27-13-19(24)25/h5,8-10,14-15H,2-4,6-7,11-13H2,1H3,(H,21,26)(H,22,23)(H,24,25) |
| InChIKey | DNAXGRPCDSXRMF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |