C18H26N2O3 — CID 95305329
(2S)-2-[(2-cyclohexylacetyl)amino]-N-[(2-hydroxyphenyl)methyl]propanamide (PubChem CID 95305329) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2S)-2-[(2-cyclohexylacetyl)amino]-N-[(2-hydroxyphenyl)methyl]propanamide.
| Compound Name | (2S)-2-[(2-cyclohexylacetyl)amino]-N-[(2-hydroxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 95305329 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2S)-2-[(2-cyclohexylacetyl)amino]-N-[(2-hydroxyphenyl)methyl]propanamide |
| SMILES | C[C@H](NC(=O)CC1CCCCC1)C(=O)NCc1ccccc1O |
| InChI | InChI=1S/C18H26N2O3/c1-13(20-17(22)11-14-7-3-2-4-8-14)18(23)19-12-15-9-5-6-10-16(15)21/h5-6,9-10,13-14,21H,2-4,7-8,11-12H2,1H3,(H,19,23)(H,20,22)/t13-/m0/s1 |
| InChIKey | WVYHTPIUPMDZPK-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|