C24H36N4O3 — CID 60615120
2-[(2-cyclohexylacetyl)amino]-N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]propanamide (PubChem CID 60615120) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[(2-cyclohexylacetyl)amino]-N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 2-[(2-cyclohexylacetyl)amino]-N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 60615120 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 2-[(2-cyclohexylacetyl)amino]-N-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]propanamide |
| SMILES | CC(NC(=O)CC1CCCCC1)C(=O)NCCC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H36N4O3/c1-19(26-22(29)18-20-8-4-2-5-9-20)24(31)25-13-12-23(30)28-16-14-27(15-17-28)21-10-6-3-7-11-21/h3,6-7,10-11,19-20H,2,4-5,8-9,12-18H2,1H3,(H,25,31)(H,26,29) |
| InChIKey | OWIUEHOGKRBTDF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |