C17H30N2O4 — CID 119219690
6-[2-[(2-cyclohexylacetyl)amino]propanoylamino]hexanoic acid (PubChem CID 119219690) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 6-[2-[(2-cyclohexylacetyl)amino]propanoylamino]hexanoic acid.
| Compound Name | 6-[2-[(2-cyclohexylacetyl)amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 119219690 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 6-[2-[(2-cyclohexylacetyl)amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)CC1CCCCC1)C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C17H30N2O4/c1-13(17(23)18-11-7-3-6-10-16(21)22)19-15(20)12-14-8-4-2-5-9-14/h13-14H,2-12H2,1H3,(H,18,23)(H,19,20)(H,21,22) |
| InChIKey | WOBADBJDWBYTDS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|