C15H27N3O3 — CID 51103870
2-[(2-cyclohexylacetyl)amino]-N-[1-(methylamino)-1-oxopropan-2-yl]propanamide (PubChem CID 51103870) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[(2-cyclohexylacetyl)amino]-N-[1-(methylamino)-1-oxopropan-2-yl]propanamide.
| Compound Name | 2-[(2-cyclohexylacetyl)amino]-N-[1-(methylamino)-1-oxopropan-2-yl]propanamide |
|---|---|
| PubChem CID | 51103870 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-[(2-cyclohexylacetyl)amino]-N-[1-(methylamino)-1-oxopropan-2-yl]propanamide |
| SMILES | CNC(=O)C(C)NC(=O)C(C)NC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C15H27N3O3/c1-10(14(20)16-3)18-15(21)11(2)17-13(19)9-12-7-5-4-6-8-12/h10-12H,4-9H2,1-3H3,(H,16,20)(H,17,19)(H,18,21) |
| InChIKey | RFPHOSUYPXQLBF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |