C16H30N2O2 — CID 145466463
2-[(2-cycloheptylacetyl)amino]-N,3,3-trimethylbutanamide (PubChem CID 145466463) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-[(2-cycloheptylacetyl)amino]-N,3,3-trimethylbutanamide.
| Compound Name | 2-[(2-cycloheptylacetyl)amino]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 145466463 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-[(2-cycloheptylacetyl)amino]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)C(NC(=O)CC1CCCCCC1)C(C)(C)C |
| InChI | InChI=1S/C16H30N2O2/c1-16(2,3)14(15(20)17-4)18-13(19)11-12-9-7-5-6-8-10-12/h12,14H,5-11H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | IMFFTGSTGBKSOJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |