C16H23NO2 — CID 79039260
N-(1-cyclohexylethyl)-2-(2-hydroxyphenyl)acetamide (PubChem CID 79039260) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-(1-cyclohexylethyl)-2-(2-hydroxyphenyl)acetamide.
| Compound Name | N-(1-cyclohexylethyl)-2-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 79039260 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(1-cyclohexylethyl)-2-(2-hydroxyphenyl)acetamide |
| SMILES | CC(NC(=O)Cc1ccccc1O)C1CCCCC1 |
| InChI | InChI=1S/C16H23NO2/c1-12(13-7-3-2-4-8-13)17-16(19)11-14-9-5-6-10-15(14)18/h5-6,9-10,12-13,18H,2-4,7-8,11H2,1H3,(H,17,19) |
| InChIKey | BCZZVESSIVGKKP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |