C22H26FNO — CID 59529154
N-[(1R)-1-cyclohexylethyl]-2-[4-(2-fluorophenyl)phenyl]acetamide (PubChem CID 59529154) has the molecular formula C22H26FNO and a molecular weight of 339.45 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexylethyl]-2-[4-(2-fluorophenyl)phenyl]acetamide.
| Compound Name | N-[(1R)-1-cyclohexylethyl]-2-[4-(2-fluorophenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 59529154 |
| Molecular Formula | C22H26FNO |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-[(1R)-1-cyclohexylethyl]-2-[4-(2-fluorophenyl)phenyl]acetamide |
| SMILES | C[C@@H](NC(=O)Cc1ccc(-c2ccccc2F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H26FNO/c1-16(18-7-3-2-4-8-18)24-22(25)15-17-11-13-19(14-12-17)20-9-5-6-10-21(20)23/h5-6,9-14,16,18H,2-4,7-8,15H2,1H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | DEFBFAAQXWNMPO-MRXNPFEDSA-N |
| XLogP | 5.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |