About N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate
N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate (PubChem CID 145496412) has the molecular formula C21H30N2O2
and a molecular weight of 342.48 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate.
Molecular Properties
| Compound Name | N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate |
| PubChem CID | 145496412 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate |
| SMILES | C[C@@H](NC(=O)Cc1ccc(-c2ccccc2)cn1)C1CCCCC1.O.[H][H] |
| InChI | InChI=1S/C21H26N2O.H2O.H2/c1-16(17-8-4-2-5-9-17)23-21(24)14-20-13-12-19(15-22-20)18-10-6-3-7-11-18;;/h3,6-7,10-13,15-17H,2,4-5,8-9,14H2,1H3,(H,23,24);1H2;1H/t16-;;/m1../s1 |
| InChIKey | XABJXGJVOOZAQE-GGMCWBHBSA-N |
| XLogP | 3.80 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate?
The IUPAC name of N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate (CID 145496412) is N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate.
What is the SMILES notation for N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate?
The canonical SMILES for N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate is C[C@@H](NC(=O)Cc1ccc(-c2ccccc2)cn1)C1CCCCC1.O.[H][H].
What is the InChIKey of N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate?
The InChIKey is XABJXGJVOOZAQE-GGMCWBHBSA-N. The full InChI is InChI=1S/C21H26N2O.H2O.H2/c1-16(17-8-4-2-5-9-17)23-21(24)14-20-13-12-19(15-22-20)18-10-6-3-7-11-18;;/h3,6-7,10-13,15-17H,2,4-5,8-9,14H2,1H3,(H,23,24);1H2;1H/t16-;;/m1../s1.
What are the key properties of N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate?
N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate has a molecular weight of 342.48 g/mol, XLogP of 3.80, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-cyclohexylethyl]-2-(5-phenyl-2-pyridinyl)acetamide;molecular hydrogen;hydrate is sourced from PubChem (CID 145496412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).