C19H26N2O5 — CID 119246566
2-[3-[[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]methyl]phenoxy]acetic acid (PubChem CID 119246566) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[3-[[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119246566 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[3-[[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(CNC(=O)CNC(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C19H26N2O5/c22-17(10-14-5-2-1-3-6-14)21-12-18(23)20-11-15-7-4-8-16(9-15)26-13-19(24)25/h4,7-9,14H,1-3,5-6,10-13H2,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | SUPLFGBPEROJIR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |