C15H19NO6S — CID 120527385
2-[3-[[(1,1-dioxothiane-2-carbonyl)amino]methyl]phenoxy]acetic acid (PubChem CID 120527385) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-[3-[[(1,1-dioxothiane-2-carbonyl)amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[(1,1-dioxothiane-2-carbonyl)amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 120527385 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-[3-[[(1,1-dioxothiane-2-carbonyl)amino]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(CNC(=O)C2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C15H19NO6S/c17-14(18)10-22-12-5-3-4-11(8-12)9-16-15(19)13-6-1-2-7-23(13,20)21/h3-5,8,13H,1-2,6-7,9-10H2,(H,16,19)(H,17,18) |
| InChIKey | DZUSAQLPZGZVQT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |