C16H21NO6S — CID 119246792
2-[3-[[(1-methylsulfonylcyclopentanecarbonyl)amino]methyl]phenoxy]acetic acid (PubChem CID 119246792) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-[3-[[(1-methylsulfonylcyclopentanecarbonyl)amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[(1-methylsulfonylcyclopentanecarbonyl)amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119246792 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[3-[[(1-methylsulfonylcyclopentanecarbonyl)amino]methyl]phenoxy]acetic acid |
| SMILES | CS(=O)(=O)C1(C(=O)NCc2cccc(OCC(=O)O)c2)CCCC1 |
| InChI | InChI=1S/C16H21NO6S/c1-24(21,22)16(7-2-3-8-16)15(20)17-10-12-5-4-6-13(9-12)23-11-14(18)19/h4-6,9H,2-3,7-8,10-11H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | KYINZMIOJBZRGD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |