C18H26N2O6S — CID 119247130
4-[4-[[(1-methylsulfonylpiperidine-2-carbonyl)amino]methyl]phenoxy]butanoic acid (PubChem CID 119247130) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is 4-[4-[[(1-methylsulfonylpiperidine-2-carbonyl)amino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[(1-methylsulfonylpiperidine-2-carbonyl)amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 119247130 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-[4-[[(1-methylsulfonylpiperidine-2-carbonyl)amino]methyl]phenoxy]butanoic acid |
| SMILES | CS(=O)(=O)N1CCCCC1C(=O)NCc1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C18H26N2O6S/c1-27(24,25)20-11-3-2-5-16(20)18(23)19-13-14-7-9-15(10-8-14)26-12-4-6-17(21)22/h7-10,16H,2-6,11-13H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | RCYPUEXOKNKANY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|