C19H24F3NO4 — CID 119247135
4-[4-[[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]methyl]phenoxy]butanoic acid (PubChem CID 119247135) has the molecular formula C19H24F3NO4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 4-[4-[[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 119247135 |
| Molecular Formula | C19H24F3NO4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-[4-[[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]methyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(CNC(=O)C2CCCCC2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H24F3NO4/c20-19(21,22)16-5-2-1-4-15(16)18(26)23-12-13-7-9-14(10-8-13)27-11-3-6-17(24)25/h7-10,15-16H,1-6,11-12H2,(H,23,26)(H,24,25) |
| InChIKey | GDHCUGJAQAEKIW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|