C20H21N3O5 — CID 119247236
4-[4-[[(3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]methyl]phenoxy]butanoic acid (PubChem CID 119247236) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 4-[4-[[(3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[(3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 119247236 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[4-[[(3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carbonyl)amino]methyl]phenoxy]butanoic acid |
| SMILES | Cc1cc(C(=O)NCc2ccc(OCCCC(=O)O)cc2)c2c(C)noc2n1 |
| InChI | InChI=1S/C20H21N3O5/c1-12-10-16(18-13(2)23-28-20(18)22-12)19(26)21-11-14-5-7-15(8-6-14)27-9-3-4-17(24)25/h5-8,10H,3-4,9,11H2,1-2H3,(H,21,26)(H,24,25) |
| InChIKey | WKEVHNGJHQRVQD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|