C16H20N2O5 — CID 11924821
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 11924821) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 11924821 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C16H20N2O5/c1-3-8-17-14(20)10(2)23-13(19)9-18-15(21)11-6-4-5-7-12(11)16(18)22/h3-5,10-12H,1,6-9H2,2H3,(H,17,20)/t10-,11-,12+/m0/s1 |
| InChIKey | PJWUFZGIADLXKV-SDDRHHMPSA-N |
| XLogP | 0.17 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|