C22H26N2O5 — CID 31429216
[(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 31429216) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | [(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 31429216 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | Cc1cc(C)c(NC(=O)[C@H](C)OC(=O)CN2C(=O)[C@H]3CC=CC[C@@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C22H26N2O5/c1-12-9-13(2)19(14(3)10-12)23-20(26)15(4)29-18(25)11-24-21(27)16-7-5-6-8-17(16)22(24)28/h5-6,9-10,15-17H,7-8,11H2,1-4H3,(H,23,26)/t15-,16-,17-/m0/s1 |
| InChIKey | NWOPPMDNJVDKJR-ULQDDVLXSA-N |
| XLogP | 2.43 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|