C11H19NO4S — CID 119248244
2-[4-(2-methyl-3-methylsulfanylpropanoyl)morpholin-2-yl]acetic acid (PubChem CID 119248244) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is 2-[4-(2-methyl-3-methylsulfanylpropanoyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(2-methyl-3-methylsulfanylpropanoyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248244 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[4-(2-methyl-3-methylsulfanylpropanoyl)morpholin-2-yl]acetic acid |
| SMILES | CSCC(C)C(=O)N1CCOC(CC(=O)O)C1 |
| InChI | InChI=1S/C11H19NO4S/c1-8(7-17-2)11(15)12-3-4-16-9(6-12)5-10(13)14/h8-9H,3-7H2,1-2H3,(H,13,14) |
| InChIKey | KTJNTKCFUSSUQR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |