C16H28N2O5 — CID 119248962
2-[4-[3-methyl-2-(3-methylbutanoylamino)butanoyl]morpholin-2-yl]acetic acid (PubChem CID 119248962) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[4-[3-methyl-2-(3-methylbutanoylamino)butanoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[3-methyl-2-(3-methylbutanoylamino)butanoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248962 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[4-[3-methyl-2-(3-methylbutanoylamino)butanoyl]morpholin-2-yl]acetic acid |
| SMILES | CC(C)CC(=O)NC(C(=O)N1CCOC(CC(=O)O)C1)C(C)C |
| InChI | InChI=1S/C16H28N2O5/c1-10(2)7-13(19)17-15(11(3)4)16(22)18-5-6-23-12(9-18)8-14(20)21/h10-12,15H,5-9H2,1-4H3,(H,17,19)(H,20,21) |
| InChIKey | SWLXHVJXMKAKOQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |