C19H27NO5 — CID 119250789
4-hydroxy-1-[2-(5-methyl-2-propan-2-ylphenoxy)propanoyl]piperidine-4-carboxylic acid (PubChem CID 119250789) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-hydroxy-1-[2-(5-methyl-2-propan-2-ylphenoxy)propanoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-[2-(5-methyl-2-propan-2-ylphenoxy)propanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119250789 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-hydroxy-1-[2-(5-methyl-2-propan-2-ylphenoxy)propanoyl]piperidine-4-carboxylic acid |
| SMILES | Cc1ccc(C(C)C)c(OC(C)C(=O)N2CCC(O)(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C19H27NO5/c1-12(2)15-6-5-13(3)11-16(15)25-14(4)17(21)20-9-7-19(24,8-10-20)18(22)23/h5-6,11-12,14,24H,7-10H2,1-4H3,(H,22,23) |
| InChIKey | XOKAMCRBRVIRCT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |