C25H34N2O3 — CID 55918183
1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-(5-methyl-2-propan-2-ylphenoxy)propan-1-one (PubChem CID 55918183) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-(5-methyl-2-propan-2-ylphenoxy)propan-1-one.
| Compound Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-(5-methyl-2-propan-2-ylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 55918183 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-2-(5-methyl-2-propan-2-ylphenoxy)propan-1-one |
| SMILES | COc1ccc(N2CCCN(C(=O)C(C)Oc3cc(C)ccc3C(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H34N2O3/c1-18(2)23-12-7-19(3)17-24(23)30-20(4)25(28)27-14-6-13-26(15-16-27)21-8-10-22(29-5)11-9-21/h7-12,17-18,20H,6,13-16H2,1-5H3 |
| InChIKey | AEWMKKMYDJGAMI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|