C16H17NO5 — CID 119251080
1-(2H-chromene-3-carbonyl)-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119251080) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-(2H-chromene-3-carbonyl)-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-(2H-chromene-3-carbonyl)-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251080 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-(2H-chromene-3-carbonyl)-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | O=C(C1=Cc2ccccc2OC1)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C16H17NO5/c18-14(17-7-5-16(21,6-8-17)15(19)20)12-9-11-3-1-2-4-13(11)22-10-12/h1-4,9,21H,5-8,10H2,(H,19,20) |
| InChIKey | XPACZTOBUHSIPL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |