C15H24N2O5 — CID 119251297
4-hydroxy-1-[2-(2-oxoazocan-1-yl)acetyl]piperidine-4-carboxylic acid (PubChem CID 119251297) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-hydroxy-1-[2-(2-oxoazocan-1-yl)acetyl]piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-[2-(2-oxoazocan-1-yl)acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251297 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-hydroxy-1-[2-(2-oxoazocan-1-yl)acetyl]piperidine-4-carboxylic acid |
| SMILES | O=C(CN1CCCCCCC1=O)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C15H24N2O5/c18-12-5-3-1-2-4-8-17(12)11-13(19)16-9-6-15(22,7-10-16)14(20)21/h22H,1-11H2,(H,20,21) |
| InChIKey | NJSJFPNHKVGBAA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |