C18H24N2O3 — CID 118770220
1-[2-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-oxoethyl]azepan-2-one (PubChem CID 118770220) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[2-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-oxoethyl]azepan-2-one.
| Compound Name | 1-[2-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-oxoethyl]azepan-2-one |
|---|---|
| PubChem CID | 118770220 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[2-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-oxoethyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CC(=O)N1CCC(O)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H24N2O3/c21-16-9-5-2-6-11-19(16)13-17(22)20-12-10-18(23,14-20)15-7-3-1-4-8-15/h1,3-4,7-8,23H,2,5-6,9-14H2 |
| InChIKey | UPTVSKRBMVOUOJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |