C15H17N3O4 — CID 90653397
3-[2-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 90653397) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-[2-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90653397 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-[2-(3-hydroxy-3-phenylpyrrolidin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)CNC1=O)N1CCC(O)(c2ccccc2)C1 |
| InChI | InChI=1S/C15H17N3O4/c19-12-8-16-14(21)18(12)9-13(20)17-7-6-15(22,10-17)11-4-2-1-3-5-11/h1-5,22H,6-10H2,(H,16,21) |
| InChIKey | ADGQPSVRMNHBLA-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|