C18H18FNO2 — CID 91777042
2-(3-fluorophenyl)-1-(3-hydroxy-3-phenylpyrrolidin-1-yl)ethanone (PubChem CID 91777042) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-(3-hydroxy-3-phenylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-(3-hydroxy-3-phenylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 91777042 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(3-fluorophenyl)-1-(3-hydroxy-3-phenylpyrrolidin-1-yl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1CCC(O)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H18FNO2/c19-16-8-4-5-14(11-16)12-17(21)20-10-9-18(22,13-20)15-6-2-1-3-7-15/h1-8,11,22H,9-10,12-13H2 |
| InChIKey | LGMYREFPPAONMZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |