C20H21NO5 — CID 119251922
4-hydroxy-1-[2-(phenoxymethyl)benzoyl]piperidine-4-carboxylic acid (PubChem CID 119251922) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 4-hydroxy-1-[2-(phenoxymethyl)benzoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-[2-(phenoxymethyl)benzoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251922 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-hydroxy-1-[2-(phenoxymethyl)benzoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(c1ccccc1COc1ccccc1)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C20H21NO5/c22-18(21-12-10-20(25,11-13-21)19(23)24)17-9-5-4-6-15(17)14-26-16-7-2-1-3-8-16/h1-9,25H,10-14H2,(H,23,24) |
| InChIKey | PSOCSSBESJVPFZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |