C18H27NO3 — CID 119252905
4-methyl-2-[[3-(2-methylphenyl)butanoylamino]methyl]pentanoic acid (PubChem CID 119252905) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-methyl-2-[[3-(2-methylphenyl)butanoylamino]methyl]pentanoic acid.
| Compound Name | 4-methyl-2-[[3-(2-methylphenyl)butanoylamino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 119252905 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 4-methyl-2-[[3-(2-methylphenyl)butanoylamino]methyl]pentanoic acid |
| SMILES | Cc1ccccc1C(C)CC(=O)NCC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C18H27NO3/c1-12(2)9-15(18(21)22)11-19-17(20)10-14(4)16-8-6-5-7-13(16)3/h5-8,12,14-15H,9-11H2,1-4H3,(H,19,20)(H,21,22) |
| InChIKey | BMHIMSKUWWAKKD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |