C11H22O2 — CID 167634596
CID 167634596 (PubChem CID 167634596) has the molecular formula C11H22O2 and a molecular weight of 193.34 g/mol.
| Compound Name | CID 167634596 |
|---|---|
| PubChem CID | 167634596 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 193.34 g/mol |
| Exact Mass | 193.21 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1C(C)CC(=O)O.[2H][2H].[2H][2H].[2H][2H].[H][2H] |
| InChI | InChI=1S/C11H14O2.4H2/c1-8-5-3-4-6-10(8)9(2)7-11(12)13;;;;/h3-6,9H,7H2,1-2H3,(H,12,13);4*1H/i;3*1+1D;1+1 |
| InChIKey | OHFUPHUPDSBTOC-LZYMUNFOSA-N |
| XLogP | 3.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |