C22H25NO4 — CID 119257603
3-methyl-1-[2-[3-[(2-methylphenyl)methoxy]phenyl]acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 119257603) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-methyl-1-[2-[3-[(2-methylphenyl)methoxy]phenyl]acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-[2-[3-[(2-methylphenyl)methoxy]phenyl]acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119257603 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-methyl-1-[2-[3-[(2-methylphenyl)methoxy]phenyl]acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccccc1COc1cccc(CC(=O)N2CCC(C)(C(=O)O)C2)c1 |
| InChI | InChI=1S/C22H25NO4/c1-16-6-3-4-8-18(16)14-27-19-9-5-7-17(12-19)13-20(24)23-11-10-22(2,15-23)21(25)26/h3-9,12H,10-11,13-15H2,1-2H3,(H,25,26) |
| InChIKey | HAJGVLPFXOWQID-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |