C20H25N3O3S — CID 119264448
N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119264448) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119264448 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | COc1ccc(-c2csc(NC(=O)C3CC4CCCCC4N3)n2)cc1OC |
| InChI | InChI=1S/C20H25N3O3S/c1-25-17-8-7-13(10-18(17)26-2)16-11-27-20(22-16)23-19(24)15-9-12-5-3-4-6-14(12)21-15/h7-8,10-12,14-15,21H,3-6,9H2,1-2H3,(H,22,23,24) |
| InChIKey | SOAJQIMYZOXNHR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |