C21H22N2O3S — CID 124818509
(1R,2R,4S)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide (PubChem CID 124818509) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is (1R,2R,4S)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
|---|---|
| PubChem CID | 124818509 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (1R,2R,4S)-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
| SMILES | COc1ccc(-c2csc(NC(=O)[C@@H]3C[C@H]4C=C[C@H]3C43CC3)n2)cc1OC |
| InChI | InChI=1S/C21H22N2O3S/c1-25-17-6-3-12(9-18(17)26-2)16-11-27-20(22-16)23-19(24)14-10-13-4-5-15(14)21(13)7-8-21/h3-6,9,11,13-15H,7-8,10H2,1-2H3,(H,22,23,24)/t13-,14-,15-/m1/s1 |
| InChIKey | LLPPSTWOHUYHLD-RBSFLKMASA-N |
| XLogP | 4.37 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|