C15H22ClN3O4S — CID 119269185
(2S)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-aminopropan-1-one;hydrochloride (PubChem CID 119269185) has the molecular formula C15H22ClN3O4S and a molecular weight of 375.88 g/mol. Its IUPAC name is (2S)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-aminopropan-1-one;hydrochloride.
| Compound Name | (2S)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-aminopropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119269185 |
| Molecular Formula | C15H22ClN3O4S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (2S)-1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-aminopropan-1-one;hydrochloride |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)[C@H](C)N)CC2)cc1.Cl |
| InChI | InChI=1S/C15H21N3O4S.ClH/c1-11(16)15(20)17-7-9-18(10-8-17)23(21,22)14-5-3-13(4-6-14)12(2)19;/h3-6,11H,7-10,16H2,1-2H3;1H/t11-;/m0./s1 |
| InChIKey | HRNSYDYKOHVLRP-MERQFXBCSA-N |
| XLogP | 0.49 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |