C15H22ClN5O3S2 — CID 119269799
2-amino-1-[4-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylsulfonyl)piperazin-1-yl]pentan-1-one;hydrochloride (PubChem CID 119269799) has the molecular formula C15H22ClN5O3S2 and a molecular weight of 419.96 g/mol. Its IUPAC name is 2-amino-1-[4-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylsulfonyl)piperazin-1-yl]pentan-1-one;hydrochloride.
| Compound Name | 2-amino-1-[4-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylsulfonyl)piperazin-1-yl]pentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119269799 |
| Molecular Formula | C15H22ClN5O3S2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-amino-1-[4-(8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-ylsulfonyl)piperazin-1-yl]pentan-1-one;hydrochloride |
| SMILES | CCCC(N)C(=O)N1CCN(S(=O)(=O)c2cccc3c2N=S=N3)CC1.Cl |
| InChI | InChI=1S/C15H21N5O3S2.ClH/c1-2-4-11(16)15(21)19-7-9-20(10-8-19)25(22,23)13-6-3-5-12-14(13)18-24-17-12;/h3,5-6,11H,2,4,7-10,16H2,1H3;1H |
| InChIKey | SWBRXIOMRMSHLU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |