C18H21ClN2O — CID 119271036
2-amino-N-[(4-chlorophenyl)-phenylmethyl]pentanamide (PubChem CID 119271036) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is 2-amino-N-[(4-chlorophenyl)-phenylmethyl]pentanamide.
| Compound Name | 2-amino-N-[(4-chlorophenyl)-phenylmethyl]pentanamide |
|---|---|
| PubChem CID | 119271036 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-amino-N-[(4-chlorophenyl)-phenylmethyl]pentanamide |
| SMILES | CCCC(N)C(=O)NC(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN2O/c1-2-6-16(20)18(22)21-17(13-7-4-3-5-8-13)14-9-11-15(19)12-10-14/h3-5,7-12,16-17H,2,6,20H2,1H3,(H,21,22) |
| InChIKey | JFZZXLORRICHTM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |