C13H26ClN3O2 — CID 119272923
1-amino-N-[2-(tert-butylamino)-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119272923) has the molecular formula C13H26ClN3O2 and a molecular weight of 291.82 g/mol. Its IUPAC name is 1-amino-N-[2-(tert-butylamino)-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-[2-(tert-butylamino)-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119272923 |
| Molecular Formula | C13H26ClN3O2 |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-amino-N-[2-(tert-butylamino)-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC(C)(C)NC(=O)CNC(=O)C1(N)CCCCC1.Cl |
| InChI | InChI=1S/C13H25N3O2.ClH/c1-12(2,3)16-10(17)9-15-11(18)13(14)7-5-4-6-8-13;/h4-9,14H2,1-3H3,(H,15,18)(H,16,17);1H |
| InChIKey | PAQHTQSTUDLVBT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |