C16H22ClN3O2S — CID 119275013
N-(1-benzoylpiperidin-4-yl)-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119275013) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is N-(1-benzoylpiperidin-4-yl)-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-(1-benzoylpiperidin-4-yl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119275013 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-(1-benzoylpiperidin-4-yl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCN(C(=O)c2ccccc2)CC1)C1CSCN1 |
| InChI | InChI=1S/C16H21N3O2S.ClH/c20-15(14-10-22-11-17-14)18-13-6-8-19(9-7-13)16(21)12-4-2-1-3-5-12;/h1-5,13-14,17H,6-11H2,(H,18,20);1H |
| InChIKey | FRAIONAQEDEMOH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |