C19H27N3O3 — CID 119277089
N-[1-(furan-2-carbonyl)piperidin-4-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119277089) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-4-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119277089 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccco2)CC1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C19H27N3O3/c23-18(16-12-13-4-1-2-5-15(13)21-16)20-14-7-9-22(10-8-14)19(24)17-6-3-11-25-17/h3,6,11,13-16,21H,1-2,4-5,7-10,12H2,(H,20,23) |
| InChIKey | MDEDNGVWCIODPX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |