C17H29N3O3S — CID 119341222
N-(1-cyclopropylsulfonylpiperidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119341222) has the molecular formula C17H29N3O3S and a molecular weight of 355.50 g/mol. Its IUPAC name is N-(1-cyclopropylsulfonylpiperidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-(1-cyclopropylsulfonylpiperidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119341222 |
| Molecular Formula | C17H29N3O3S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(1-cyclopropylsulfonylpiperidin-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)C2CC2)CC1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C17H29N3O3S/c21-17(16-11-12-3-1-2-4-15(12)19-16)18-13-7-9-20(10-8-13)24(22,23)14-5-6-14/h12-16,19H,1-11H2,(H,18,21) |
| InChIKey | ZUZXDYRDDWGOGE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |