C14H25ClN2OS — CID 119313222
N-(thian-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119313222) has the molecular formula C14H25ClN2OS and a molecular weight of 304.89 g/mol. Its IUPAC name is N-(thian-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-(thian-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119313222 |
| Molecular Formula | C14H25ClN2OS |
| Molecular Weight | 304.89 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(thian-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCSCC1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C14H24N2OS.ClH/c17-14(15-11-5-7-18-8-6-11)13-9-10-3-1-2-4-12(10)16-13;/h10-13,16H,1-9H2,(H,15,17);1H |
| InChIKey | MJHZWYYKKDPBDK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.89 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |